C30H34N2O4 — CID 134815655
4-[(8aS)-5,5,8a-trimethyl-2-(3-morpholin-4-ylbenzoyl)-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid (PubChem CID 134815655) has the molecular formula C30H34N2O4 and a molecular weight of 486.61 g/mol. Its IUPAC name is 4-[(8aS)-5,5,8a-trimethyl-2-(3-morpholin-4-ylbenzoyl)-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid.
| Compound Name | 4-[(8aS)-5,5,8a-trimethyl-2-(3-morpholin-4-ylbenzoyl)-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid |
|---|---|
| PubChem CID | 134815655 |
| Molecular Formula | C30H34N2O4 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.25 |
| IUPAC Name | 4-[(8aS)-5,5,8a-trimethyl-2-(3-morpholin-4-ylbenzoyl)-3,8-dihydro-1H-isoquinolin-6-yl]benzoic acid |
| SMILES | CC1(C)C(c2ccc(C(=O)O)cc2)=CC[C@]2(C)CN(C(=O)c3cccc(N4CCOCC4)c3)CC=C12 |
| InChI | InChI=1S/C30H34N2O4/c1-29(2)25(21-7-9-22(10-8-21)28(34)35)11-13-30(3)20-32(14-12-26(29)30)27(33)23-5-4-6-24(19-23)31-15-17-36-18-16-31/h4-12,19H,13-18,20H2,1-3H3,(H,34,35)/t30-/m1/s1 |
| InChIKey | QBTQJXKZMTVHSK-SSEXGKCCSA-N |
| XLogP | 5.12 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|