C22H12F6N2O6 — CID 134815790
(Z)-4-[2,4-dioxo-1,3-bis[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 134815790) has the molecular formula C22H12F6N2O6 and a molecular weight of 514.33 g/mol. Its IUPAC name is (Z)-4-[2,4-dioxo-1,3-bis[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | (Z)-4-[2,4-dioxo-1,3-bis[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 134815790 |
| Molecular Formula | C22H12F6N2O6 |
| Molecular Weight | 514.33 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | (Z)-4-[2,4-dioxo-1,3-bis[4-(trifluoromethyl)phenyl]pyrimidin-5-yl]-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)/C=C(\O)c1cn(-c2ccc(C(F)(F)F)cc2)c(=O)n(-c2ccc(C(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C22H12F6N2O6/c23-21(24,25)11-1-5-13(6-2-11)29-10-15(16(31)9-17(32)19(34)35)18(33)30(20(29)36)14-7-3-12(4-8-14)22(26,27)28/h1-10,31H,(H,34,35)/b16-9- |
| InChIKey | GMGRNQONXABAMG-SXGWCWSVSA-N |
| XLogP | 3.58 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|