About 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one
3-ethyl-4,7-dihydroxy-1H-quinolin-2-one (PubChem CID 134815930) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one |
| PubChem CID | 134815930 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one |
| SMILES | CCc1c(O)c2ccc(O)cc2[nH]c1=O |
| InChI | InChI=1S/C11H11NO3/c1-2-7-10(14)8-4-3-6(13)5-9(8)12-11(7)15/h3-5,13H,2H2,1H3,(H2,12,14,15) |
| InChIKey | HBXZIVYCWUYXPJ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one?
The IUPAC name of 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one (CID 134815930) is 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one.
What is the SMILES notation for 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one?
The canonical SMILES for 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one is CCc1c(O)c2ccc(O)cc2[nH]c1=O.
What is the InChIKey of 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one?
The InChIKey is HBXZIVYCWUYXPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-2-7-10(14)8-4-3-6(13)5-9(8)12-11(7)15/h3-5,13H,2H2,1H3,(H2,12,14,15).
What are the key properties of 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one?
3-ethyl-4,7-dihydroxy-1H-quinolin-2-one has a molecular weight of 205.21 g/mol, XLogP of 1.50, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4,7-dihydroxy-1H-quinolin-2-one is sourced from PubChem (CID 134815930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).