About [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride
[1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride (PubChem CID 134816279) has the molecular formula C14H14ClF3N3OS+
and a molecular weight of 364.80 g/mol. Its IUPAC name is [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride |
| PubChem CID | 134816279 |
| Molecular Formula | C14H14ClF3N3OS+ |
| Molecular Weight | 364.80 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride |
| SMILES | Cl.N/C(=N\Cc1ccccc1)Sc1ccc(C(F)(F)F)c[n+]1O |
| InChI | InChI=1S/C14H13F3N3OS.ClH/c15-14(16,17)11-6-7-12(20(21)9-11)22-13(18)19-8-10-4-2-1-3-5-10;/h1-7,9,21H,8H2,(H2,18,19);1H/q+1; |
| InChIKey | VZBLXFKGRODNHC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride?
The IUPAC name of [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride (CID 134816279) is [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride.
What is the SMILES notation for [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride?
The canonical SMILES for [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride is Cl.N/C(=N\Cc1ccccc1)Sc1ccc(C(F)(F)F)c[n+]1O.
What is the InChIKey of [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride?
The InChIKey is VZBLXFKGRODNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F3N3OS.ClH/c15-14(16,17)11-6-7-12(20(21)9-11)22-13(18)19-8-10-4-2-1-3-5-10;/h1-7,9,21H,8H2,(H2,18,19);1H/q+1;.
What are the key properties of [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride?
[1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride has a molecular weight of 364.80 g/mol, XLogP of 3.26, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-hydroxy-5-(trifluoromethyl)pyridin-1-ium-2-yl] N'-benzylcarbamimidothioate;hydrochloride is sourced from PubChem (CID 134816279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).