C25H35ClN7O5P — CID 134816760
pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-chlorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoate (PubChem CID 134816760) has the molecular formula C25H35ClN7O5P and a molecular weight of 580.03 g/mol. Its IUPAC name is pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-chlorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoate.
| Compound Name | pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-chlorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 134816760 |
| Molecular Formula | C25H35ClN7O5P |
| Molecular Weight | 580.03 g/mol |
| Exact Mass | 579.21 |
| IUPAC Name | pentyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-chlorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCCCOC(=O)C(C)(C)NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H35ClN7O5P/c1-5-6-7-12-37-24(35)25(3,4)32-39(36,31-23(34)18-8-10-19(26)11-9-18)16-38-17(2)13-33-15-30-20-21(27)28-14-29-22(20)33/h8-11,14-15,17H,5-7,12-13,16H2,1-4H3,(H2,27,28,29)(H2,31,32,34,36)/t17-,39?/m1/s1 |
| InChIKey | UQAPINDGQHQTEV-ODBKVJQVSA-N |
| XLogP | 4.15 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.03 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|