C23H31ClN7O5P — CID 134816782
propyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-chlorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoate (PubChem CID 134816782) has the molecular formula C23H31ClN7O5P and a molecular weight of 551.97 g/mol. Its IUPAC name is propyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-chlorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoate.
| Compound Name | propyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-chlorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 134816782 |
| Molecular Formula | C23H31ClN7O5P |
| Molecular Weight | 551.97 g/mol |
| Exact Mass | 551.18 |
| IUPAC Name | propyl 2-[[[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethyl-[(4-chlorobenzoyl)amino]phosphoryl]amino]-2-methylpropanoate |
| SMILES | CCCOC(=O)C(C)(C)NP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H31ClN7O5P/c1-5-10-35-22(33)23(3,4)30-37(34,29-21(32)16-6-8-17(24)9-7-16)14-36-15(2)11-31-13-28-18-19(25)26-12-27-20(18)31/h6-9,12-13,15H,5,10-11,14H2,1-4H3,(H2,25,26,27)(H2,29,30,32,34)/t15-,37?/m1/s1 |
| InChIKey | RNUHVTRITJMGPO-GZPZAFJTSA-N |
| XLogP | 3.37 |
| TPSA | 163.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.97 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|