About 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide
5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 134816802) has the molecular formula C20H16N4O2S
and a molecular weight of 376.44 g/mol. Its IUPAC name is 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide |
| PubChem CID | 134816802 |
| Molecular Formula | C20H16N4O2S |
| Molecular Weight | 376.44 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | Cc1ccc(Nc2nc(-c3cc(C(=O)Nc4ccccc4)no3)cs2)cc1 |
| InChI | InChI=1S/C20H16N4O2S/c1-13-7-9-15(10-8-13)22-20-23-17(12-27-20)18-11-16(24-26-18)19(25)21-14-5-3-2-4-6-14/h2-12H,1H3,(H,21,25)(H,22,23) |
| InChIKey | SOBIABRVMNYJRI-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide?
The IUPAC name of 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide (CID 134816802) is 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide.
What is the SMILES notation for 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide?
The canonical SMILES for 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide is Cc1ccc(Nc2nc(-c3cc(C(=O)Nc4ccccc4)no3)cs2)cc1.
What is the InChIKey of 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide?
The InChIKey is SOBIABRVMNYJRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N4O2S/c1-13-7-9-15(10-8-13)22-20-23-17(12-27-20)18-11-16(24-26-18)19(25)21-14-5-3-2-4-6-14/h2-12H,1H3,(H,21,25)(H,22,23).
What are the key properties of 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide?
5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide has a molecular weight of 376.44 g/mol, XLogP of 5.10, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(4-methylanilino)-1,3-thiazol-4-yl]-N-phenyl-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 134816802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).