C19H36N4O5 — CID 134817506
(2R,3R,4R,5S)-2-(hydroxymethyl)-1-[9-[4-(methoxymethyl)triazol-1-yl]nonyl]piperidine-3,4,5-triol (PubChem CID 134817506) has the molecular formula C19H36N4O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[9-[4-(methoxymethyl)triazol-1-yl]nonyl]piperidine-3,4,5-triol.
| Compound Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[9-[4-(methoxymethyl)triazol-1-yl]nonyl]piperidine-3,4,5-triol |
|---|---|
| PubChem CID | 134817506 |
| Molecular Formula | C19H36N4O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.27 |
| IUPAC Name | (2R,3R,4R,5S)-2-(hydroxymethyl)-1-[9-[4-(methoxymethyl)triazol-1-yl]nonyl]piperidine-3,4,5-triol |
| SMILES | COCc1cn(CCCCCCCCCN2C[C@H](O)[C@@H](O)[C@H](O)[C@H]2CO)nn1 |
| InChI | InChI=1S/C19H36N4O5/c1-28-14-15-11-23(21-20-15)10-8-6-4-2-3-5-7-9-22-12-17(25)19(27)18(26)16(22)13-24/h11,16-19,24-27H,2-10,12-14H2,1H3/t16-,17+,18-,19-/m1/s1 |
| InChIKey | XGVWMUFCIMYWGD-FCGDIQPGSA-N |
| XLogP | -0.09 |
| TPSA | 124.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|