C20H37N — CID 134817775
(E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-4-en-1-amine (PubChem CID 134817775) has the molecular formula C20H37N and a molecular weight of 291.52 g/mol. Its IUPAC name is (E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-4-en-1-amine.
| Compound Name | (E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-4-en-1-amine |
|---|---|
| PubChem CID | 134817775 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | (E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)non-4-en-1-amine |
| SMILES | CC1=C(CCC(C)C/C=C/C(C)CCN)C(C)(C)CCC1 |
| InChI | InChI=1S/C20H37N/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,9,16-17H,7-8,10-15,21H2,1-5H3/b9-6+ |
| InChIKey | YPBTVYHMRBOWDF-RMKNXTFCSA-N |
| XLogP | 5.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|