C32H32O16S4 — CID 134817790
25,27-diethoxy-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid (PubChem CID 134817790) has the molecular formula C32H32O16S4 and a molecular weight of 800.86 g/mol. Its IUPAC name is 25,27-diethoxy-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid.
| Compound Name | 25,27-diethoxy-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid |
|---|---|
| PubChem CID | 134817790 |
| Molecular Formula | C32H32O16S4 |
| Molecular Weight | 800.86 g/mol |
| Exact Mass | 800.06 |
| IUPAC Name | 25,27-diethoxy-26,28-dihydroxypentacyclo[19.3.1.13,7.19,13.115,19]octacosa-1(24),3,5,7(28),9,11,13(27),15(26),16,18,21(25),22-dodecaene-5,11,17,23-tetrasulfonic acid |
| SMILES | CCOc1c2cc(S(=O)(=O)O)cc1Cc1cc(S(=O)(=O)O)cc(c1O)Cc1cc(S(=O)(=O)O)cc(c1OCC)Cc1cc(S(=O)(=O)O)cc(c1O)C2 |
| InChI | InChI=1S/C32H32O16S4/c1-3-47-31-21-5-17-9-25(49(35,36)37)11-19(29(17)33)7-23-15-28(52(44,45)46)16-24(32(23)48-4-2)8-20-12-26(50(38,39)40)10-18(30(20)34)6-22(31)14-27(13-21)51(41,42)43/h9-16,33-34H,3-8H2,1-2H3,(H,35,36,37)(H,38,39,40)(H,41,42,43)(H,44,45,46) |
| InChIKey | ZYMWNEBEPHJITE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 276.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.86 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|