About 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one
3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one (PubChem CID 134818054) has the molecular formula C27H40N2O
and a molecular weight of 408.63 g/mol. Its IUPAC name is 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one.
Molecular Properties
| Compound Name | 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
| PubChem CID | 134818054 |
| Molecular Formula | C27H40N2O |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.31 |
| IUPAC Name | 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
| SMILES | O=C1C2CN(C34CC5CC(CC(C5)C3)C4)CC1CN(C13CC4CC(CC(C4)C1)C3)C2 |
| InChI | InChI=1S/C27H40N2O/c30-25-23-13-28(26-7-17-1-18(8-26)3-19(2-17)9-26)14-24(25)16-29(15-23)27-10-20-4-21(11-27)6-22(5-20)12-27/h17-24H,1-16H2 |
| InChIKey | VNYMTUSVDKHBDE-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one?
The IUPAC name of 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one (CID 134818054) is 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one.
What is the SMILES notation for 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one?
The canonical SMILES for 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one is O=C1C2CN(C34CC5CC(CC(C5)C3)C4)CC1CN(C13CC4CC(CC(C4)C1)C3)C2.
What is the InChIKey of 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one?
The InChIKey is VNYMTUSVDKHBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H40N2O/c30-25-23-13-28(26-7-17-1-18(8-26)3-19(2-17)9-26)14-24(25)16-29(15-23)27-10-20-4-21(11-27)6-22(5-20)12-27/h17-24H,1-16H2.
What are the key properties of 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one?
3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one has a molecular weight of 408.63 g/mol, XLogP of 4.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-bis(1-adamantyl)-3,7-diazabicyclo[3.3.1]nonan-9-one is sourced from PubChem (CID 134818054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).