C26H38N10O3 — CID 134819398
3-[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]purin-2-yl]-1,2,4-oxadiazolidin-5-one (PubChem CID 134819398) has the molecular formula C26H38N10O3 and a molecular weight of 538.66 g/mol. Its IUPAC name is 3-[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]purin-2-yl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]purin-2-yl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 134819398 |
| Molecular Formula | C26H38N10O3 |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | 3-[6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]-8-[1-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]purin-2-yl]-1,2,4-oxadiazolidin-5-one |
| SMILES | Cc1noc(C(C)Nc2nc3nc(C4NOC(=O)N4)nc(N[C@H](C)C4CCC4)c3n2CC2CCC(C)CC2)n1 |
| InChI | InChI=1S/C26H38N10O3/c1-13-8-10-17(11-9-13)12-36-19-20(27-14(2)18-6-5-7-18)30-22(23-33-26(37)39-35-23)31-21(19)32-25(36)28-15(3)24-29-16(4)34-38-24/h13-15,17-18,23,35H,5-12H2,1-4H3,(H,33,37)(H2,27,28,30,31,32)/t13?,14-,15?,17?,23?/m1/s1 |
| InChIKey | GUZNUUQLFKZWBU-JELXMZGXSA-N |
| XLogP | 4.36 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |