C29H44N8O3 — CID 134819401
3-[8-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-1,2,4-oxadiazolidin-5-one (PubChem CID 134819401) has the molecular formula C29H44N8O3 and a molecular weight of 552.72 g/mol. Its IUPAC name is 3-[8-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[8-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 134819401 |
| Molecular Formula | C29H44N8O3 |
| Molecular Weight | 552.72 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | 3-[8-(2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]oxazin-4-yl)-6-[[(1R)-1-cyclobutylethyl]amino]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-1,2,4-oxadiazolidin-5-one |
| SMILES | CC1CCC(Cn2c(N3CCOC4CCCCC43)nc3nc(C4NOC(=O)N4)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C29H44N8O3/c1-17-10-12-19(13-11-17)16-37-23-24(30-18(2)20-6-5-7-20)31-26(27-34-29(38)40-35-27)32-25(23)33-28(37)36-14-15-39-22-9-4-3-8-21(22)36/h17-22,27,35H,3-16H2,1-2H3,(H,34,38)(H,30,31,32)/t17?,18-,19?,21?,22?,27?/m1/s1 |
| InChIKey | FQBYQDQBTOFQIF-ZSQAKLFHSA-N |
| XLogP | 4.64 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |