C27H42N8O3 — CID 134819427
3-[6-[[(1R)-1-cyclobutylethyl]amino]-8-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-1,2,4-oxadiazolidin-5-one (PubChem CID 134819427) has the molecular formula C27H42N8O3 and a molecular weight of 526.69 g/mol. Its IUPAC name is 3-[6-[[(1R)-1-cyclobutylethyl]amino]-8-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[6-[[(1R)-1-cyclobutylethyl]amino]-8-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 134819427 |
| Molecular Formula | C27H42N8O3 |
| Molecular Weight | 526.69 g/mol |
| Exact Mass | 526.34 |
| IUPAC Name | 3-[6-[[(1R)-1-cyclobutylethyl]amino]-8-[(3R,5R)-3,5-dimethylmorpholin-4-yl]-7-[(4-methylcyclohexyl)methyl]purin-2-yl]-1,2,4-oxadiazolidin-5-one |
| SMILES | CC1CCC(Cn2c(N3[C@H](C)COC[C@H]3C)nc3nc(C4NOC(=O)N4)nc(N[C@H](C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C27H42N8O3/c1-15-8-10-19(11-9-15)12-34-21-22(28-18(4)20-6-5-7-20)29-24(25-32-27(36)38-33-25)30-23(21)31-26(34)35-16(2)13-37-14-17(35)3/h15-20,25,33H,5-14H2,1-4H3,(H,32,36)(H,28,29,30)/t15?,16-,17-,18-,19?,25?/m1/s1 |
| InChIKey | KEHVORNGAKGTLL-WZJKUGFHSA-N |
| XLogP | 4.11 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.69 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |