C30H33ClN8O3 — CID 134819521
3-[6-(2-chloro-4-pyridinyl)-7-[(4-methylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]-1,2,4-oxadiazolidin-5-one (PubChem CID 134819521) has the molecular formula C30H33ClN8O3 and a molecular weight of 589.10 g/mol. Its IUPAC name is 3-[6-(2-chloro-4-pyridinyl)-7-[(4-methylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[6-(2-chloro-4-pyridinyl)-7-[(4-methylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 134819521 |
| Molecular Formula | C30H33ClN8O3 |
| Molecular Weight | 589.10 g/mol |
| Exact Mass | 588.24 |
| IUPAC Name | 3-[6-(2-chloro-4-pyridinyl)-7-[(4-methylcyclohexyl)methyl]-8-[(3R)-3-phenylmorpholin-4-yl]purin-2-yl]-1,2,4-oxadiazolidin-5-one |
| SMILES | CC1CCC(Cn2c(N3CCOC[C@H]3c3ccccc3)nc3nc(C4NOC(=O)N4)nc(-c4ccnc(Cl)c4)c32)CC1 |
| InChI | InChI=1S/C30H33ClN8O3/c1-18-7-9-19(10-8-18)16-39-25-24(21-11-12-32-23(31)15-21)33-27(28-36-30(40)42-37-28)34-26(25)35-29(39)38-13-14-41-17-22(38)20-5-3-2-4-6-20/h2-6,11-12,15,18-19,22,28,37H,7-10,13-14,16-17H2,1H3,(H,36,40)/t18?,19?,22-,28?/m0/s1 |
| InChIKey | DBYYGSSYBCUKKP-VJHPIBRESA-N |
| XLogP | 5.19 |
| TPSA | 119.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.10 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|