C19H23FN6O3 — CID 134819749
[2-fluoro-3-[4-(2-methoxypyrimidin-5-yl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 134819749) has the molecular formula C19H23FN6O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is [2-fluoro-3-[4-(2-methoxypyrimidin-5-yl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate.
| Compound Name | [2-fluoro-3-[4-(2-methoxypyrimidin-5-yl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
|---|---|
| PubChem CID | 134819749 |
| Molecular Formula | C19H23FN6O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | [2-fluoro-3-[4-(2-methoxypyrimidin-5-yl)piperazin-1-yl]phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(c3cnc(OC)nc3)CC2)c1F |
| InChI | InChI=1S/C19H23FN6O3/c1-28-19-23-10-14(11-24-19)25-5-7-26(8-6-25)15-4-2-3-13(18(15)20)12-29-17(27)9-16(21)22/h2-4,10-11H,5-9,12H2,1H3,(H3,21,22) |
| InChIKey | DMPREDBFPKKLEC-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|