About [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate
[2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate (PubChem CID 134819765) has the molecular formula C21H23FN6O2
and a molecular weight of 410.45 g/mol. Its IUPAC name is [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate.
Molecular Properties
| Compound Name | [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate |
| PubChem CID | 134819765 |
| Molecular Formula | C21H23FN6O2 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate |
| SMILES | [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(c3ccn4ccnc4c3)CC2)c1F |
| InChI | InChI=1S/C21H23FN6O2/c22-21-15(14-30-20(29)13-18(23)24)2-1-3-17(21)27-10-8-26(9-11-27)16-4-6-28-7-5-25-19(28)12-16/h1-7,12H,8-11,13-14H2,(H3,23,24) |
| InChIKey | ILOBYYXMAMWGHX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 99.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate?
The IUPAC name of [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate (CID 134819765) is [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate.
What is the SMILES notation for [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate?
The canonical SMILES for [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate is [H]/N=C(\N)CC(=O)OCc1cccc(N2CCN(c3ccn4ccnc4c3)CC2)c1F.
What is the InChIKey of [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate?
The InChIKey is ILOBYYXMAMWGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23FN6O2/c22-21-15(14-30-20(29)13-18(23)24)2-1-3-17(21)27-10-8-26(9-11-27)16-4-6-28-7-5-25-19(28)12-16/h1-7,12H,8-11,13-14H2,(H3,23,24).
What are the key properties of [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate?
[2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate has a molecular weight of 410.45 g/mol, XLogP of 2.17, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-fluoro-3-(4-imidazo[1,2-a]pyridin-7-ylpiperazin-1-yl)phenyl]methyl 3-amino-3-iminopropanoate is sourced from PubChem (CID 134819765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).