C26H42O9 — CID 134820089
9-[(E)-4-[(2S,4R,5R)-4,5-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-3-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid (PubChem CID 134820089) has the molecular formula C26H42O9 and a molecular weight of 498.61 g/mol. Its IUPAC name is 9-[(E)-4-[(2S,4R,5R)-4,5-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-3-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid.
| Compound Name | 9-[(E)-4-[(2S,4R,5R)-4,5-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-3-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
|---|---|
| PubChem CID | 134820089 |
| Molecular Formula | C26H42O9 |
| Molecular Weight | 498.61 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 9-[(E)-4-[(2S,4R,5R)-4,5-dihydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-3-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoic acid |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)O)C[C@@H]1OC[C@](O)(C/C=C/[C@@H](C)[C@H](C)O)[C@@H](O)C1=O |
| InChI | InChI=1S/C26H42O9/c1-18(16-23(30)34-14-9-7-5-4-6-8-12-22(28)29)15-21-24(31)25(32)26(33,17-35-21)13-10-11-19(2)20(3)27/h10-11,16,19-21,25,27,32-33H,4-9,12-15,17H2,1-3H3,(H,28,29)/b11-10+,18-16+/t19-,20+,21+,25+,26-/m1/s1 |
| InChIKey | GORQBTCDLGULNV-YOESYUKXSA-N |
| XLogP | 2.70 |
| TPSA | 150.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|