About 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol
4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol (PubChem CID 134820091) has the molecular formula C18H23N2O2+
and a molecular weight of 299.39 g/mol. Its IUPAC name is 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol.
Molecular Properties
| Compound Name | 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol |
| PubChem CID | 134820091 |
| Molecular Formula | C18H23N2O2+ |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol |
| SMILES | Oc1ccc(C[C@H]2C[NH2+][C@@H](Cc3ccc(O)cc3)CN2)cc1 |
| InChI | InChI=1S/C18H22N2O2/c21-17-5-1-13(2-6-17)9-15-11-20-16(12-19-15)10-14-3-7-18(22)8-4-14/h1-8,15-16,19-22H,9-12H2/p+1/t15-,16-/m0/s1 |
| InChIKey | CMWOCHXOAOFYCY-HOTGVXAUSA-O |
| XLogP | 0.79 |
| TPSA | 69.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol?
The IUPAC name of 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol (CID 134820091) is 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol.
What is the SMILES notation for 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol?
The canonical SMILES for 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol is Oc1ccc(C[C@H]2C[NH2+][C@@H](Cc3ccc(O)cc3)CN2)cc1.
What is the InChIKey of 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol?
The InChIKey is CMWOCHXOAOFYCY-HOTGVXAUSA-O. The full InChI is InChI=1S/C18H22N2O2/c21-17-5-1-13(2-6-17)9-15-11-20-16(12-19-15)10-14-3-7-18(22)8-4-14/h1-8,15-16,19-22H,9-12H2/p+1/t15-,16-/m0/s1.
What are the key properties of 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol?
4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol has a molecular weight of 299.39 g/mol, XLogP of 0.79, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2S,5S)-5-[(4-hydroxyphenyl)methyl]piperazin-4-ium-2-yl]methyl]phenol is sourced from PubChem (CID 134820091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).