C26H41O8- — CID 134820189
9-[(E)-4-[(2S,3S,5S)-3-hydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate (PubChem CID 134820189) has the molecular formula C26H41O8- and a molecular weight of 481.61 g/mol. Its IUPAC name is 9-[(E)-4-[(2S,3S,5S)-3-hydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate.
| Compound Name | 9-[(E)-4-[(2S,3S,5S)-3-hydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate |
|---|---|
| PubChem CID | 134820189 |
| Molecular Formula | C26H41O8- |
| Molecular Weight | 481.61 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | 9-[(E)-4-[(2S,3S,5S)-3-hydroxy-5-[(E,4R,5S)-5-hydroxy-4-methylhex-2-enyl]-4-oxooxan-2-yl]-3-methylbut-2-enoyl]oxynonanoate |
| SMILES | C/C(=C\C(=O)OCCCCCCCCC(=O)[O-])C[C@@H]1OC[C@H](C/C=C/[C@@H](C)[C@H](C)O)C(=O)[C@H]1O |
| InChI | InChI=1S/C26H42O8/c1-18(16-24(30)33-14-9-7-5-4-6-8-13-23(28)29)15-22-26(32)25(31)21(17-34-22)12-10-11-19(2)20(3)27/h10-11,16,19-22,26-27,32H,4-9,12-15,17H2,1-3H3,(H,28,29)/p-1/b11-10+,18-16+/t19-,20+,21+,22+,26+/m1/s1 |
| InChIKey | TWMBWHWFDNILHM-NDUXWHGBSA-M |
| XLogP | 2.25 |
| TPSA | 133.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.61 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|