C25H8F15GeN — CID 134820839
tris(2,3,4,5,6-pentafluorophenyl)-(2-pyridin-4-ylethyl)germane (PubChem CID 134820839) has the molecular formula C25H8F15GeN and a molecular weight of 679.93 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-(2-pyridin-4-ylethyl)germane.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-(2-pyridin-4-ylethyl)germane |
|---|---|
| PubChem CID | 134820839 |
| Molecular Formula | C25H8F15GeN |
| Molecular Weight | 679.93 g/mol |
| Exact Mass | 680.96 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-(2-pyridin-4-ylethyl)germane |
| SMILES | Fc1c(F)c(F)c([Ge](CCc2ccncc2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C25H8F15GeN/c26-8-11(29)17(35)23(18(36)12(8)30)41(4-1-7-2-5-42-6-3-7,24-19(37)13(31)9(27)14(32)20(24)38)25-21(39)15(33)10(28)16(34)22(25)40/h2-3,5-6H,1,4H2 |
| InChIKey | GKZRKEQRAQCNBW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.93 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|