C24H37BO2 — CID 134821145
2-[1-cyclohexyl-3-(2,6-dimethylphenyl)cyclobutyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 134821145) has the molecular formula C24H37BO2 and a molecular weight of 368.37 g/mol. Its IUPAC name is 2-[1-cyclohexyl-3-(2,6-dimethylphenyl)cyclobutyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[1-cyclohexyl-3-(2,6-dimethylphenyl)cyclobutyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134821145 |
| Molecular Formula | C24H37BO2 |
| Molecular Weight | 368.37 g/mol |
| Exact Mass | 368.29 |
| IUPAC Name | 2-[1-cyclohexyl-3-(2,6-dimethylphenyl)cyclobutyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | Cc1cccc(C)c1C1CC(B2OC(C)(C)C(C)(C)O2)(C2CCCCC2)C1 |
| InChI | InChI=1S/C24H37BO2/c1-17-11-10-12-18(2)21(17)19-15-24(16-19,20-13-8-7-9-14-20)25-26-22(3,4)23(5,6)27-25/h10-12,19-20H,7-9,13-16H2,1-6H3 |
| InChIKey | LXUUUTRZVYBBHR-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.37 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|