C13H17NO3 — CID 134821259
1-[(2,3-dihydroxyphenyl)methyl]azepan-2-one (PubChem CID 134821259) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-[(2,3-dihydroxyphenyl)methyl]azepan-2-one.
| Compound Name | 1-[(2,3-dihydroxyphenyl)methyl]azepan-2-one |
|---|---|
| PubChem CID | 134821259 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-[(2,3-dihydroxyphenyl)methyl]azepan-2-one |
| SMILES | O=C1CCCCCN1Cc1cccc(O)c1O |
| InChI | InChI=1S/C13H17NO3/c15-11-6-4-5-10(13(11)17)9-14-8-3-1-2-7-12(14)16/h4-6,15,17H,1-3,7-9H2 |
| InChIKey | HIVTTYYKQIFENB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|