About N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride
N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride (PubChem CID 134821643) has the molecular formula C13H23ClN2O
and a molecular weight of 258.79 g/mol. Its IUPAC name is N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride.
Molecular Properties
| Compound Name | N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride |
| PubChem CID | 134821643 |
| Molecular Formula | C13H23ClN2O |
| Molecular Weight | 258.79 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride |
| SMILES | CCN(CC)CC(=O)NC1C[C@@H]2C=C[C@H]1C2.Cl |
| InChI | InChI=1S/C13H22N2O.ClH/c1-3-15(4-2)9-13(16)14-12-8-10-5-6-11(12)7-10;/h5-6,10-12H,3-4,7-9H2,1-2H3,(H,14,16);1H/t10-,11+,12?;/m1./s1 |
| InChIKey | KIGJAUXSQIEGAA-WCGHQRNMSA-N |
| XLogP | 1.83 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.79 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride?
The IUPAC name of N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride (CID 134821643) is N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride.
What is the SMILES notation for N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride?
The canonical SMILES for N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride is CCN(CC)CC(=O)NC1C[C@@H]2C=C[C@H]1C2.Cl.
What is the InChIKey of N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride?
The InChIKey is KIGJAUXSQIEGAA-WCGHQRNMSA-N. The full InChI is InChI=1S/C13H22N2O.ClH/c1-3-15(4-2)9-13(16)14-12-8-10-5-6-11(12)7-10;/h5-6,10-12H,3-4,7-9H2,1-2H3,(H,14,16);1H/t10-,11+,12?;/m1./s1.
What are the key properties of N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride?
N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride has a molecular weight of 258.79 g/mol, XLogP of 1.83, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,4R)-2-bicyclo[2.2.1]hept-5-enyl]-2-(diethylamino)acetamide;hydrochloride is sourced from PubChem (CID 134821643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).