C84H54O12 — CID 134821679
4-[4-[2,3,4,5,6-pentakis[4-(4-carboxyphenyl)phenyl]phenyl]phenyl]benzoic acid (PubChem CID 134821679) has the molecular formula C84H54O12 and a molecular weight of 1255.34 g/mol. Its IUPAC name is 4-[4-[2,3,4,5,6-pentakis[4-(4-carboxyphenyl)phenyl]phenyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[2,3,4,5,6-pentakis[4-(4-carboxyphenyl)phenyl]phenyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 134821679 |
| Molecular Formula | C84H54O12 |
| Molecular Weight | 1255.34 g/mol |
| Exact Mass | 1254.36 |
| IUPAC Name | 4-[4-[2,3,4,5,6-pentakis[4-(4-carboxyphenyl)phenyl]phenyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(-c3c(-c4ccc(-c5ccc(C(=O)O)cc5)cc4)c(-c4ccc(-c5ccc(C(=O)O)cc5)cc4)c(-c4ccc(-c5ccc(C(=O)O)cc5)cc4)c(-c4ccc(-c5ccc(C(=O)O)cc5)cc4)c3-c3ccc(-c4ccc(C(=O)O)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C84H54O12/c85-79(86)67-37-13-55(14-38-67)49-1-25-61(26-2-49)73-74(62-27-3-50(4-28-62)56-15-39-68(40-16-56)80(87)88)76(64-31-7-52(8-32-64)58-19-43-70(44-20-58)82(91)92)78(66-35-11-54(12-36-66)60-23-47-72(48-24-60)84(95)96)77(65-33-9-53(10-34-65)59-21-45-71(46-22-59)83(93)94)75(73)63-29-5-51(6-30-63)57-17-41-69(42-18-57)81(89)90/h1-48H,(H,85,86)(H,87,88)(H,89,90)(H,91,92)(H,93,94)(H,95,96) |
| InChIKey | LLLSQRNDRHARFZ-UHFFFAOYSA-N |
| XLogP | 19.88 |
| TPSA | 223.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 96 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1255.34 |
| LogP ≤ 5 | 19.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |