C26H19ClFN3O2S2 — CID 134821709
(3S,6S)-3-(2-chlorophenyl)sulfanyl-6-[6-(4-fluoroanilino)-2-pyridinyl]-6-thiophen-3-ylpiperidine-2,4-dione (PubChem CID 134821709) has the molecular formula C26H19ClFN3O2S2 and a molecular weight of 524.04 g/mol. Its IUPAC name is (3S,6S)-3-(2-chlorophenyl)sulfanyl-6-[6-(4-fluoroanilino)-2-pyridinyl]-6-thiophen-3-ylpiperidine-2,4-dione.
| Compound Name | (3S,6S)-3-(2-chlorophenyl)sulfanyl-6-[6-(4-fluoroanilino)-2-pyridinyl]-6-thiophen-3-ylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 134821709 |
| Molecular Formula | C26H19ClFN3O2S2 |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 523.06 |
| IUPAC Name | (3S,6S)-3-(2-chlorophenyl)sulfanyl-6-[6-(4-fluoroanilino)-2-pyridinyl]-6-thiophen-3-ylpiperidine-2,4-dione |
| SMILES | O=C1C[C@](c2ccsc2)(c2cccc(Nc3ccc(F)cc3)n2)NC(=O)[C@H]1Sc1ccccc1Cl |
| InChI | InChI=1S/C26H19ClFN3O2S2/c27-19-4-1-2-5-21(19)35-24-20(32)14-26(31-25(24)33,16-12-13-34-15-16)22-6-3-7-23(30-22)29-18-10-8-17(28)9-11-18/h1-13,15,24H,14H2,(H,29,30)(H,31,33)/t24-,26-/m0/s1 |
| InChIKey | QQAHTOHBFSHZCZ-AHWVRZQESA-N |
| XLogP | 6.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|