About 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate
2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate (PubChem CID 134821835) has the molecular formula C6H8F4N2O5S2
and a molecular weight of 328.27 g/mol. Its IUPAC name is 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate |
| PubChem CID | 134821835 |
| Molecular Formula | C6H8F4N2O5S2 |
| Molecular Weight | 328.27 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate |
| SMILES | Cc1n(S(=O)(=O)F)cc[n+]1C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C5H8FN2O2S.CHF3O3S/c1-5-7(2)3-4-8(5)11(6,9)10;2-1(3,4)8(5,6)7/h3-4H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YAZBWGHMIMMBFC-UHFFFAOYSA-M |
| XLogP | -0.27 |
| TPSA | 100.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate?
The IUPAC name of 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate (CID 134821835) is 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate.
What is the SMILES notation for 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate?
The canonical SMILES for 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate is Cc1n(S(=O)(=O)F)cc[n+]1C.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate?
The InChIKey is YAZBWGHMIMMBFC-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8FN2O2S.CHF3O3S/c1-5-7(2)3-4-8(5)11(6,9)10;2-1(3,4)8(5,6)7/h3-4H,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate?
2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate has a molecular weight of 328.27 g/mol, XLogP of -0.27, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylimidazol-3-ium-1-sulfonyl fluoride;trifluoromethanesulfonate is sourced from PubChem (CID 134821835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).