C15H25NO4 — CID 134822212
(2S)-2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]pentanedioic acid (PubChem CID 134822212) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is (2S)-2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 134822212 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | (2S)-2-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]pentanedioic acid |
| SMILES | CC(C)=CCC/C(C)=C/CN[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H25NO4/c1-11(2)5-4-6-12(3)9-10-16-13(15(19)20)7-8-14(17)18/h5,9,13,16H,4,6-8,10H2,1-3H3,(H,17,18)(H,19,20)/b12-9+/t13-/m0/s1 |
| InChIKey | WRAUYKHQSOIVEN-SRXBQZRASA-N |
| XLogP | 2.59 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|