C26H30N12O6 — CID 134822671
(1S,2R,3R,4S,6R)-4,6-diazido-3-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-3-deuterio-4,5-bis(phenylmethoxy)oxan-2-yl]oxycyclohexane-1,2-diol (PubChem CID 134822671) has the molecular formula C26H30N12O6 and a molecular weight of 607.61 g/mol. Its IUPAC name is (1S,2R,3R,4S,6R)-4,6-diazido-3-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-3-deuterio-4,5-bis(phenylmethoxy)oxan-2-yl]oxycyclohexane-1,2-diol.
| Compound Name | (1S,2R,3R,4S,6R)-4,6-diazido-3-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-3-deuterio-4,5-bis(phenylmethoxy)oxan-2-yl]oxycyclohexane-1,2-diol |
|---|---|
| PubChem CID | 134822671 |
| Molecular Formula | C26H30N12O6 |
| Molecular Weight | 607.61 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | (1S,2R,3R,4S,6R)-4,6-diazido-3-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-3-deuterio-4,5-bis(phenylmethoxy)oxan-2-yl]oxycyclohexane-1,2-diol |
| SMILES | [2H][C@]1(N=[N+]=[N-])[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@H](N=[N+]=[N-])C[C@@H]2N=[N+]=[N-])O[C@H](CN=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H30N12O6/c27-35-31-12-19-24(41-13-15-7-3-1-4-8-15)25(42-14-16-9-5-2-6-10-16)20(34-38-30)26(43-19)44-23-18(33-37-29)11-17(32-36-28)21(39)22(23)40/h1-10,17-26,39-40H,11-14H2/t17-,18+,19-,20-,21+,22-,23-,24-,25-,26-/m1/s1/i20D |
| InChIKey | GGHBOANAVHGEAZ-XRRIWPPHSA-N |
| XLogP | 4.74 |
| TPSA | 272.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|