C22H25NO4S — CID 134822674
(3aR,6S,7R,7aR)-1,3a-dimethyl-6-(4-methylphenyl)sulfanyl-7-phenylmethoxy-4,6,7,7a-tetrahydropyrano[4,3-d][1,3]oxazol-2-one (PubChem CID 134822674) has the molecular formula C22H25NO4S and a molecular weight of 399.51 g/mol. Its IUPAC name is (3aR,6S,7R,7aR)-1,3a-dimethyl-6-(4-methylphenyl)sulfanyl-7-phenylmethoxy-4,6,7,7a-tetrahydropyrano[4,3-d][1,3]oxazol-2-one.
| Compound Name | (3aR,6S,7R,7aR)-1,3a-dimethyl-6-(4-methylphenyl)sulfanyl-7-phenylmethoxy-4,6,7,7a-tetrahydropyrano[4,3-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 134822674 |
| Molecular Formula | C22H25NO4S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (3aR,6S,7R,7aR)-1,3a-dimethyl-6-(4-methylphenyl)sulfanyl-7-phenylmethoxy-4,6,7,7a-tetrahydropyrano[4,3-d][1,3]oxazol-2-one |
| SMILES | Cc1ccc(S[C@@H]2OC[C@]3(C)OC(=O)N(C)[C@@H]3[C@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO4S/c1-15-9-11-17(12-10-15)28-20-18(25-13-16-7-5-4-6-8-16)19-22(2,14-26-20)27-21(24)23(19)3/h4-12,18-20H,13-14H2,1-3H3/t18-,19-,20+,22+/m1/s1 |
| InChIKey | HJFBGTQLTLEWRM-JBPLPALLSA-N |
| XLogP | 4.24 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |