C24H22ClN5O4 — CID 134823347
1-[(4-chlorophenyl)methyl]-2-[4-(1,2-oxazol-3-yloxy)anilino]-6-oxo-N-prop-2-enyl-4,5-dihydropyrimidine-5-carboxamide (PubChem CID 134823347) has the molecular formula C24H22ClN5O4 and a molecular weight of 479.92 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-2-[4-(1,2-oxazol-3-yloxy)anilino]-6-oxo-N-prop-2-enyl-4,5-dihydropyrimidine-5-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-2-[4-(1,2-oxazol-3-yloxy)anilino]-6-oxo-N-prop-2-enyl-4,5-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 134823347 |
| Molecular Formula | C24H22ClN5O4 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-2-[4-(1,2-oxazol-3-yloxy)anilino]-6-oxo-N-prop-2-enyl-4,5-dihydropyrimidine-5-carboxamide |
| SMILES | C=CCNC(=O)C1CN=C(Nc2ccc(Oc3ccon3)cc2)N(Cc2ccc(Cl)cc2)C1=O |
| InChI | InChI=1S/C24H22ClN5O4/c1-2-12-26-22(31)20-14-27-24(30(23(20)32)15-16-3-5-17(25)6-4-16)28-18-7-9-19(10-8-18)34-21-11-13-33-29-21/h2-11,13,20H,1,12,14-15H2,(H,26,31)(H,27,28) |
| InChIKey | PFPXVLXAVWBOOQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|