About 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide
3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide (PubChem CID 134823541) has the molecular formula C14H15N7O2S2
and a molecular weight of 377.46 g/mol. Its IUPAC name is 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide |
| PubChem CID | 134823541 |
| Molecular Formula | C14H15N7O2S2 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide |
| SMILES | Nc1nc2c(-c3cccc(S(N)(=O)=O)c3C3NNNN3)cccc2s1 |
| InChI | InChI=1S/C14H15N7O2S2/c15-14-17-12-8(4-1-5-9(12)24-14)7-3-2-6-10(25(16,22)23)11(7)13-18-20-21-19-13/h1-6,13,18-21H,(H2,15,17)(H2,16,22,23) |
| InChIKey | HBHWSTSLOKQFEE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 147.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide?
The IUPAC name of 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide (CID 134823541) is 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide.
What is the SMILES notation for 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide?
The canonical SMILES for 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide is Nc1nc2c(-c3cccc(S(N)(=O)=O)c3C3NNNN3)cccc2s1.
What is the InChIKey of 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide?
The InChIKey is HBHWSTSLOKQFEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N7O2S2/c15-14-17-12-8(4-1-5-9(12)24-14)7-3-2-6-10(25(16,22)23)11(7)13-18-20-21-19-13/h1-6,13,18-21H,(H2,15,17)(H2,16,22,23).
What are the key properties of 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide?
3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide has a molecular weight of 377.46 g/mol, XLogP of 0.31, 3 rotatable bonds, 6 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-amino-1,3-benzothiazol-4-yl)-2-(tetrazolidin-5-yl)benzenesulfonamide is sourced from PubChem (CID 134823541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).