C16H19F3N6O2S — CID 134823680
3-[4-(2-aminoethyl)phenyl]-2-(tetrazolidin-5-yl)-6-(trifluoromethyl)benzenesulfonamide (PubChem CID 134823680) has the molecular formula C16H19F3N6O2S and a molecular weight of 416.43 g/mol. Its IUPAC name is 3-[4-(2-aminoethyl)phenyl]-2-(tetrazolidin-5-yl)-6-(trifluoromethyl)benzenesulfonamide.
| Compound Name | 3-[4-(2-aminoethyl)phenyl]-2-(tetrazolidin-5-yl)-6-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134823680 |
| Molecular Formula | C16H19F3N6O2S |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 3-[4-(2-aminoethyl)phenyl]-2-(tetrazolidin-5-yl)-6-(trifluoromethyl)benzenesulfonamide |
| SMILES | NCCc1ccc(-c2ccc(C(F)(F)F)c(S(N)(=O)=O)c2C2NNNN2)cc1 |
| InChI | InChI=1S/C16H19F3N6O2S/c17-16(18,19)12-6-5-11(10-3-1-9(2-4-10)7-8-20)13(14(12)28(21,26)27)15-22-24-25-23-15/h1-6,15,22-25H,7-8,20H2,(H2,21,26,27) |
| InChIKey | OOVCPNFFGDHZGD-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |