About 3-nitro-1,2-dihydroimidazole
3-nitro-1,2-dihydroimidazole (PubChem CID 134824419) has the molecular formula C3H5N3O2
and a molecular weight of 115.09 g/mol. Its IUPAC name is 3-nitro-1,2-dihydroimidazole.
Molecular Properties
| Compound Name | 3-nitro-1,2-dihydroimidazole |
| PubChem CID | 134824419 |
| Molecular Formula | C3H5N3O2 |
| Molecular Weight | 115.09 g/mol |
| Exact Mass | 115.04 |
| IUPAC Name | 3-nitro-1,2-dihydroimidazole |
| SMILES | O=[N+]([O-])N1C=CNC1 |
| InChI | InChI=1S/C3H5N3O2/c7-6(8)5-2-1-4-3-5/h1-2,4H,3H2 |
| InChIKey | FHEJATWJLUCSNE-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.09 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-1,2-dihydroimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-1,2-dihydroimidazole?
The IUPAC name of 3-nitro-1,2-dihydroimidazole (CID 134824419) is 3-nitro-1,2-dihydroimidazole.
What is the SMILES notation for 3-nitro-1,2-dihydroimidazole?
The canonical SMILES for 3-nitro-1,2-dihydroimidazole is O=[N+]([O-])N1C=CNC1.
What is the InChIKey of 3-nitro-1,2-dihydroimidazole?
The InChIKey is FHEJATWJLUCSNE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5N3O2/c7-6(8)5-2-1-4-3-5/h1-2,4H,3H2.
What are the key properties of 3-nitro-1,2-dihydroimidazole?
3-nitro-1,2-dihydroimidazole has a molecular weight of 115.09 g/mol, XLogP of -0.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-1,2-dihydroimidazole is sourced from PubChem (CID 134824419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).