C30H42N6O9 — CID 134826276
3-[(3S,6S,12S,15S,18S)-15-[(4-hydroxyphenyl)methyl]-12-methyl-3-(2-methylpropyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-6-yl]propanoic acid (PubChem CID 134826276) has the molecular formula C30H42N6O9 and a molecular weight of 630.70 g/mol. Its IUPAC name is 3-[(3S,6S,12S,15S,18S)-15-[(4-hydroxyphenyl)methyl]-12-methyl-3-(2-methylpropyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-6-yl]propanoic acid.
| Compound Name | 3-[(3S,6S,12S,15S,18S)-15-[(4-hydroxyphenyl)methyl]-12-methyl-3-(2-methylpropyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-6-yl]propanoic acid |
|---|---|
| PubChem CID | 134826276 |
| Molecular Formula | C30H42N6O9 |
| Molecular Weight | 630.70 g/mol |
| Exact Mass | 630.30 |
| IUPAC Name | 3-[(3S,6S,12S,15S,18S)-15-[(4-hydroxyphenyl)methyl]-12-methyl-3-(2-methylpropyl)-2,5,8,11,14,17-hexaoxo-1,4,7,10,13,16-hexazabicyclo[16.3.0]henicosan-6-yl]propanoic acid |
| SMILES | CC(C)C[C@@H]1NC(=O)[C@H](CCC(=O)O)NC(=O)CNC(=O)[C@H](C)NC(=O)[C@H](Cc2ccc(O)cc2)NC(=O)[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C30H42N6O9/c1-16(2)13-22-30(45)36-12-4-5-23(36)29(44)34-21(14-18-6-8-19(37)9-7-18)28(43)32-17(3)26(41)31-15-24(38)33-20(27(42)35-22)10-11-25(39)40/h6-9,16-17,20-23,37H,4-5,10-15H2,1-3H3,(H,31,41)(H,32,43)(H,33,38)(H,34,44)(H,35,42)(H,39,40)/t17-,20-,21-,22-,23-/m0/s1 |
| InChIKey | LDHBBVCFTOPPCB-RSYUGDCRSA-N |
| XLogP | -1.07 |
| TPSA | 223.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.70 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |