C22H31N5O8 — CID 134826769
4-[[(2S)-1-[[(2S)-1-[[(2S)-4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 134826769) has the molecular formula C22H31N5O8 and a molecular weight of 493.52 g/mol. Its IUPAC name is 4-[[(2S)-1-[[(2S)-1-[[(2S)-4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[(2S)-1-[[(2S)-1-[[(2S)-4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 134826769 |
| Molecular Formula | C22H31N5O8 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.22 |
| IUPAC Name | 4-[[(2S)-1-[[(2S)-1-[[(2S)-4-methyl-1-(4-nitroanilino)-1-oxopentan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)CCC(=O)O)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H31N5O8/c1-12(2)11-17(22(33)25-15-5-7-16(8-6-15)27(34)35)26-21(32)14(4)24-20(31)13(3)23-18(28)9-10-19(29)30/h5-8,12-14,17H,9-11H2,1-4H3,(H,23,28)(H,24,31)(H,25,33)(H,26,32)(H,29,30)/t13-,14-,17-/m0/s1 |
| InChIKey | UXMWFXJGOURANY-ZQIUZPCESA-N |
| XLogP | 0.94 |
| TPSA | 196.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|