C21H35N7O6 — CID 134827323
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]propanoyl]amino]-4-methylpentanoic acid (PubChem CID 134827323) has the molecular formula C21H35N7O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]propanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]propanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 134827323 |
| Molecular Formula | C21H35N7O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]propanoyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]propanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)[C@H](C)NC(=O)[C@H](C)N)C(=O)O |
| InChI | InChI=1S/C21H35N7O6/c1-10(2)6-16(21(33)34)28-19(31)13(5)26-20(32)15(7-14-8-23-9-24-14)27-18(30)12(4)25-17(29)11(3)22/h8-13,15-16H,6-7,22H2,1-5H3,(H,23,24)(H,25,29)(H,26,32)(H,27,30)(H,28,31)(H,33,34)/t11-,12-,13-,15-,16-/m0/s1 |
| InChIKey | DYWDPJNDNDJVFW-IICXDKKESA-N |
| XLogP | -1.59 |
| TPSA | 208.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |