C40H45N7O5 — CID 134827859
(2S)-3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (PubChem CID 134827859) has the molecular formula C40H45N7O5 and a molecular weight of 703.84 g/mol. Its IUPAC name is (2S)-3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid.
| Compound Name | (2S)-3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| PubChem CID | 134827859 |
| Molecular Formula | C40H45N7O5 |
| Molecular Weight | 703.84 g/mol |
| Exact Mass | 703.35 |
| IUPAC Name | (2S)-3-[3,5-bis[[bis(pyridin-2-ylmethyl)amino]methyl]-4-hydroxyphenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1cc(CN(Cc2ccccn2)Cc2ccccn2)c(O)c(CN(Cc2ccccn2)Cc2ccccn2)c1)C(=O)O |
| InChI | InChI=1S/C40H45N7O5/c1-40(2,3)52-39(51)45-36(38(49)50)22-29-20-30(23-46(25-32-12-4-8-16-41-32)26-33-13-5-9-17-42-33)37(48)31(21-29)24-47(27-34-14-6-10-18-43-34)28-35-15-7-11-19-44-35/h4-21,36,48H,22-28H2,1-3H3,(H,45,51)(H,49,50)/t36-/m0/s1 |
| InChIKey | POFLTUZGQMXAPG-BHVANESWSA-N |
| XLogP | 5.90 |
| TPSA | 153.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.84 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|