(3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride

C6H13ClFN — CID 134827939

IUPAC(3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride
SMILESC[C@@H]1C[NH2+]CC[C@@H]1F.[Cl-]
InChIInChI=1S/C6H12FN.ClH/c1-5-4-8-3-2-6(5)7;/h5-6,8H,2-4H2,1H3;1H/t5-,6+;/m1./s1
InChIKeyPIOKCSLVDACPII-IBTYICNHSA-N
MW153.63 g/mol
LogP-3.07
Rot. Bonds

About (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride

(3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride (PubChem CID 134827939) has the molecular formula C6H13ClFN and a molecular weight of 153.63 g/mol. Its IUPAC name is (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride.

Molecular Properties

Compound Name(3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride
PubChem CID134827939
Molecular FormulaC6H13ClFN
Molecular Weight153.63 g/mol
Exact Mass153.07
IUPAC Name(3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride
SMILESC[C@@H]1C[NH2+]CC[C@@H]1F.[Cl-]
InChIInChI=1S/C6H12FN.ClH/c1-5-4-8-3-2-6(5)7;/h5-6,8H,2-4H2,1H3;1H/t5-,6+;/m1./s1
InChIKeyPIOKCSLVDACPII-IBTYICNHSA-N
XLogP-3.07
TPSA16.61 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.63
LogP ≤ 5-3.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride?
The IUPAC name of (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride (CID 134827939) is (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride.
What is the SMILES notation for (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride?
The canonical SMILES for (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride is C[C@@H]1C[NH2+]CC[C@@H]1F.[Cl-].
What is the InChIKey of (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride?
The InChIKey is PIOKCSLVDACPII-IBTYICNHSA-N. The full InChI is InChI=1S/C6H12FN.ClH/c1-5-4-8-3-2-6(5)7;/h5-6,8H,2-4H2,1H3;1H/t5-,6+;/m1./s1.
What are the key properties of (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride?
(3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride has a molecular weight of 153.63 g/mol, XLogP of -3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-fluoro-3-methylpiperidin-1-ium chloride is sourced from PubChem (CID 134827939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).