C17H28N2 — CID 134827959
(1S,2R,10R,11R)-3,16-diazatetracyclo[8.8.1.02,7.011,16]nonadec-7-ene (PubChem CID 134827959) has the molecular formula C17H28N2 and a molecular weight of 260.42 g/mol. Its IUPAC name is (1S,2R,10R,11R)-3,16-diazatetracyclo[8.8.1.02,7.011,16]nonadec-7-ene.
| Compound Name | (1S,2R,10R,11R)-3,16-diazatetracyclo[8.8.1.02,7.011,16]nonadec-7-ene |
|---|---|
| PubChem CID | 134827959 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.42 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (1S,2R,10R,11R)-3,16-diazatetracyclo[8.8.1.02,7.011,16]nonadec-7-ene |
| SMILES | C1=C2CCCN[C@@H]2[C@@H]2CCN3CCCC[C@@H]3[C@H](C1)C2 |
| InChI | InChI=1S/C17H28N2/c1-2-10-19-11-8-15-12-14(16(19)5-1)7-6-13-4-3-9-18-17(13)15/h6,14-18H,1-5,7-12H2/t14-,15-,16-,17+/m1/s1 |
| InChIKey | SKZLOTRHYKMAOJ-VQHPVUNQSA-N |
| XLogP | 2.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.42 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|