C26H37NO6 — CID 134827990
4-[(E,5S)-7-[(2R,3S,4R,6E,10E)-4-hydroxy-3-methyl-12-oxo-1-oxacyclododeca-6,10-dien-2-yl]-5-methyl-4-oxooct-6-enyl]piperidine-2,6-dione (PubChem CID 134827990) has the molecular formula C26H37NO6 and a molecular weight of 459.58 g/mol. Its IUPAC name is 4-[(E,5S)-7-[(2R,3S,4R,6E,10E)-4-hydroxy-3-methyl-12-oxo-1-oxacyclododeca-6,10-dien-2-yl]-5-methyl-4-oxooct-6-enyl]piperidine-2,6-dione.
| Compound Name | 4-[(E,5S)-7-[(2R,3S,4R,6E,10E)-4-hydroxy-3-methyl-12-oxo-1-oxacyclododeca-6,10-dien-2-yl]-5-methyl-4-oxooct-6-enyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 134827990 |
| Molecular Formula | C26H37NO6 |
| Molecular Weight | 459.58 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | 4-[(E,5S)-7-[(2R,3S,4R,6E,10E)-4-hydroxy-3-methyl-12-oxo-1-oxacyclododeca-6,10-dien-2-yl]-5-methyl-4-oxooct-6-enyl]piperidine-2,6-dione |
| SMILES | C/C(=C\[C@H](C)C(=O)CCCC1CC(=O)NC(=O)C1)[C@@H]1OC(=O)/C=C/CC/C=C/C[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C26H37NO6/c1-17(21(28)12-9-10-20-15-23(30)27-24(31)16-20)14-18(2)26-19(3)22(29)11-7-5-4-6-8-13-25(32)33-26/h5,7-8,13-14,17,19-20,22,26,29H,4,6,9-12,15-16H2,1-3H3,(H,27,30,31)/b7-5+,13-8+,18-14+/t17-,19-,22+,26-/m0/s1 |
| InChIKey | SBOCUPFPPJWMJW-JHKKMVOOSA-N |
| XLogP | 3.57 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.58 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|