C14H23N — CID 134827995
(1R,8R,9S,11S)-6,9,11-trimethyl-12-azatricyclo[6.3.1.04,12]dodec-5-ene (PubChem CID 134827995) has the molecular formula C14H23N and a molecular weight of 205.34 g/mol. Its IUPAC name is (1R,8R,9S,11S)-6,9,11-trimethyl-12-azatricyclo[6.3.1.04,12]dodec-5-ene.
| Compound Name | (1R,8R,9S,11S)-6,9,11-trimethyl-12-azatricyclo[6.3.1.04,12]dodec-5-ene |
|---|---|
| PubChem CID | 134827995 |
| Molecular Formula | C14H23N |
| Molecular Weight | 205.34 g/mol |
| Exact Mass | 205.18 |
| IUPAC Name | (1R,8R,9S,11S)-6,9,11-trimethyl-12-azatricyclo[6.3.1.04,12]dodec-5-ene |
| SMILES | CC1=CC2CC[C@@H]3[C@@H](C)C[C@H](C)[C@@H](C1)N23 |
| InChI | InChI=1S/C14H23N/c1-9-6-12-4-5-13-10(2)8-11(3)14(7-9)15(12)13/h6,10-14H,4-5,7-8H2,1-3H3/t10-,11-,12?,13+,14+/m0/s1 |
| InChIKey | GZLDGJFXXOEXDX-JZWBPQTPSA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|