C20H25NO4 — CID 134828011
(6R)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-5-oxo-2,3,6,7-tetrahydropyrrolizine-1-carboxylic acid (PubChem CID 134828011) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (6R)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-5-oxo-2,3,6,7-tetrahydropyrrolizine-1-carboxylic acid.
| Compound Name | (6R)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-5-oxo-2,3,6,7-tetrahydropyrrolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 134828011 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (6R)-6-[(1S,2S,4aR,8aS)-2-methyl-1,2,4a,5,6,7,8,8a-octahydronaphthalene-1-carbonyl]-5-oxo-2,3,6,7-tetrahydropyrrolizine-1-carboxylic acid |
| SMILES | C[C@H]1C=C[C@H]2CCCC[C@@H]2[C@H]1C(=O)[C@H]1CC2=C(C(=O)O)CCN2C1=O |
| InChI | InChI=1S/C20H25NO4/c1-11-6-7-12-4-2-3-5-13(12)17(11)18(22)15-10-16-14(20(24)25)8-9-21(16)19(15)23/h6-7,11-13,15,17H,2-5,8-10H2,1H3,(H,24,25)/t11-,12+,13-,15+,17-/m0/s1 |
| InChIKey | PLDSPVZUSKNZIH-CBAJHEILSA-N |
| XLogP | 2.77 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|