C20H28O5 — CID 134828023
5-[(1R,5S,7S,9S,10R,11R)-11-hydroxy-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]-2-methylpentanoic acid (PubChem CID 134828023) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is 5-[(1R,5S,7S,9S,10R,11R)-11-hydroxy-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]-2-methylpentanoic acid.
| Compound Name | 5-[(1R,5S,7S,9S,10R,11R)-11-hydroxy-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]-2-methylpentanoic acid |
|---|---|
| PubChem CID | 134828023 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | 5-[(1R,5S,7S,9S,10R,11R)-11-hydroxy-5,9-dimethyl-4-oxo-8-oxatetracyclo[7.2.1.17,10.01,6]tridec-2-en-5-yl]-2-methylpentanoic acid |
| SMILES | CC(CCCC1(C)C(=O)C=C[C@@]23C[C@]4(C)O[C@@H](C[C@@H]4[C@H]2O)C13)C(=O)O |
| InChI | InChI=1S/C20H28O5/c1-11(17(23)24)5-4-7-18(2)14(21)6-8-20-10-19(3)12(16(20)22)9-13(25-19)15(18)20/h6,8,11-13,15-16,22H,4-5,7,9-10H2,1-3H3,(H,23,24)/t11?,12-,13+,15?,16-,18?,19+,20+/m1/s1 |
| InChIKey | JLRQZDBEHUSUGY-JYOIRVJWSA-N |
| XLogP | 2.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |