About 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride
4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride (PubChem CID 134828118) has the molecular formula C13H22ClN3O
and a molecular weight of 271.79 g/mol. Its IUPAC name is 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride.
Molecular Properties
| Compound Name | 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride |
| PubChem CID | 134828118 |
| Molecular Formula | C13H22ClN3O |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride |
| SMILES | CN(C)CCCC(=O)N(C)Nc1ccccc1.Cl |
| InChI | InChI=1S/C13H21N3O.ClH/c1-15(2)11-7-10-13(17)16(3)14-12-8-5-4-6-9-12;/h4-6,8-9,14H,7,10-11H2,1-3H3;1H |
| InChIKey | QHGPFSYXPIILAY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride?
The IUPAC name of 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride (CID 134828118) is 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride.
What is the SMILES notation for 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride?
The canonical SMILES for 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride is CN(C)CCCC(=O)N(C)Nc1ccccc1.Cl.
What is the InChIKey of 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride?
The InChIKey is QHGPFSYXPIILAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O.ClH/c1-15(2)11-7-10-13(17)16(3)14-12-8-5-4-6-9-12;/h4-6,8-9,14H,7,10-11H2,1-3H3;1H.
What are the key properties of 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride?
4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride has a molecular weight of 271.79 g/mol, XLogP of 2.24, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dimethylamino)-N-methyl-N'-phenylbutanehydrazide;hydrochloride is sourced from PubChem (CID 134828118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).