About 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile
5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile (PubChem CID 13482831) has the molecular formula C11H9NO2
and a molecular weight of 187.20 g/mol. Its IUPAC name is 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile.
Molecular Properties
| Compound Name | 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile |
| PubChem CID | 13482831 |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.06 |
| IUPAC Name | 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile |
| SMILES | N#CC1CCOc2ccccc2C1=O |
| InChI | InChI=1S/C11H9NO2/c12-7-8-5-6-14-10-4-2-1-3-9(10)11(8)13/h1-4,8H,5-6H2 |
| InChIKey | KIEHHAWEFOETGN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|
Analyze 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile?
The IUPAC name of 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile (CID 13482831) is 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile.
What is the SMILES notation for 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile?
The canonical SMILES for 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile is N#CC1CCOc2ccccc2C1=O.
What is the InChIKey of 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile?
The InChIKey is KIEHHAWEFOETGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NO2/c12-7-8-5-6-14-10-4-2-1-3-9(10)11(8)13/h1-4,8H,5-6H2.
What are the key properties of 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile?
5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile has a molecular weight of 187.20 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-3,4-dihydro-2H-1-benzoxepine-4-carbonitrile is sourced from PubChem (CID 13482831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).