About 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one
7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one (PubChem CID 134828339) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one.
Molecular Properties
| Compound Name | 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one |
| PubChem CID | 134828339 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one |
| SMILES | CC1(C)NC(=O)Nc2cc(N)ccc21 |
| InChI | InChI=1S/C10H13N3O/c1-10(2)7-4-3-6(11)5-8(7)12-9(14)13-10/h3-5H,11H2,1-2H3,(H2,12,13,14) |
| InChIKey | RYGQDMABHVUNOL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one?
The IUPAC name of 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one (CID 134828339) is 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one.
What is the SMILES notation for 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one?
The canonical SMILES for 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one is CC1(C)NC(=O)Nc2cc(N)ccc21.
What is the InChIKey of 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one?
The InChIKey is RYGQDMABHVUNOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-10(2)7-4-3-6(11)5-8(7)12-9(14)13-10/h3-5H,11H2,1-2H3,(H2,12,13,14).
What are the key properties of 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one?
7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one has a molecular weight of 191.23 g/mol, XLogP of 1.64, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-4,4-dimethyl-1,3-dihydroquinazolin-2-one is sourced from PubChem (CID 134828339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).