C20H22FN2O3S+ — CID 134828589
[(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-(4-fluoro-2-thiophen-2-ylphenyl)carbamate (PubChem CID 134828589) has the molecular formula C20H22FN2O3S+ and a molecular weight of 389.47 g/mol. Its IUPAC name is [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-(4-fluoro-2-thiophen-2-ylphenyl)carbamate.
| Compound Name | [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-(4-fluoro-2-thiophen-2-ylphenyl)carbamate |
|---|---|
| PubChem CID | 134828589 |
| Molecular Formula | C20H22FN2O3S+ |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | [(1R,2R,4S,5S)-9,9-dimethyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] N-(4-fluoro-2-thiophen-2-ylphenyl)carbamate |
| SMILES | C[N+]1(C)[C@@H]2CC(OC(=O)Nc3ccc(F)cc3-c3cccs3)C[C@H]1[C@@H]1O[C@@H]12 |
| InChI | InChI=1S/C20H21FN2O3S/c1-23(2)15-9-12(10-16(23)19-18(15)26-19)25-20(24)22-14-6-5-11(21)8-13(14)17-4-3-7-27-17/h3-8,12,15-16,18-19H,9-10H2,1-2H3/p+1/t12?,15-,16+,18-,19+ |
| InChIKey | YBYUWXNCRPKGOH-WTJZDURDSA-O |
| XLogP | 3.86 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|