About N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine
N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine (PubChem CID 134828864) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine |
| PubChem CID | 134828864 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine |
| SMILES | CCCNC[C@@H]1CC[C@H]2NC[C@H]2O1 |
| InChI | InChI=1S/C10H20N2O/c1-2-5-11-6-8-3-4-9-10(13-8)7-12-9/h8-12H,2-7H2,1H3/t8-,9+,10+/m0/s1 |
| InChIKey | SXXNBWZJYZOSNS-IVZWLZJFSA-N |
| XLogP | 0.51 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine?
The IUPAC name of N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine (CID 134828864) is N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine.
What is the SMILES notation for N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine?
The canonical SMILES for N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine is CCCNC[C@@H]1CC[C@H]2NC[C@H]2O1.
What is the InChIKey of N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine?
The InChIKey is SXXNBWZJYZOSNS-IVZWLZJFSA-N. The full InChI is InChI=1S/C10H20N2O/c1-2-5-11-6-8-3-4-9-10(13-8)7-12-9/h8-12H,2-7H2,1H3/t8-,9+,10+/m0/s1.
What are the key properties of N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine?
N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine has a molecular weight of 184.28 g/mol, XLogP of 0.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1R,3S,6R)-2-oxa-7-azabicyclo[4.2.0]octan-3-yl]methyl]propan-1-amine is sourced from PubChem (CID 134828864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).