C17H22N2O2 — CID 134828873
[(1S,2aS,8bS)-1-(hydroxymethyl)-2a,3,4,8b-tetrahydro-1H-azeto[2,3-c]quinolin-2-yl]-cyclopentylmethanone (PubChem CID 134828873) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(1S,2aS,8bS)-1-(hydroxymethyl)-2a,3,4,8b-tetrahydro-1H-azeto[2,3-c]quinolin-2-yl]-cyclopentylmethanone.
| Compound Name | [(1S,2aS,8bS)-1-(hydroxymethyl)-2a,3,4,8b-tetrahydro-1H-azeto[2,3-c]quinolin-2-yl]-cyclopentylmethanone |
|---|---|
| PubChem CID | 134828873 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [(1S,2aS,8bS)-1-(hydroxymethyl)-2a,3,4,8b-tetrahydro-1H-azeto[2,3-c]quinolin-2-yl]-cyclopentylmethanone |
| SMILES | O=C(C1CCCC1)N1[C@H](CO)[C@H]2c3ccccc3NC[C@H]21 |
| InChI | InChI=1S/C17H22N2O2/c20-10-15-16-12-7-3-4-8-13(12)18-9-14(16)19(15)17(21)11-5-1-2-6-11/h3-4,7-8,11,14-16,18,20H,1-2,5-6,9-10H2/t14-,15-,16+/m1/s1 |
| InChIKey | RVNITZXRTJCMDC-OAGGEKHMSA-N |
| XLogP | 1.96 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |